Informationen zur Darstellung dieser Seite in älteren Browsern
Universitaet Hamburg Fachbereich Chemie

Synonym Index [136/259]

<< < 1... 21... 41... 61... 81... 101... 121... 131 132 133 134 135 136 137 138 139 140 141 ...161 ...181 ...201 ...221 ...241 > >>

1 2 3 4 5 6 7 8 9 A  B C D E F G H I J K L M N O  P Q R S T U V W X Y Z 

Disperse Blue 90
Disperse Blue 98
Disperse Blue K
Disperse brown 106
Disperse brown 195
Disperse brown 210
Disperse brown 242
Disperse brown 247
Disperse brown 44
Disperse green 85
Disperse Orange 1
Disperse orange 106
Disperse orange 107
Disperse orange 13
Disperse Orange 149
Disperse orange 25
Disperse Orange 26
Disperse Orange 3
Disperse Orange 37
Disperse Orange 39
Disperse Orange 60
Disperse Red
Disperse red 1
Disperse Red 1 acrylate
Disperse Red 1 methacrylate
Disperse red 11
Disperse Red 13
Disperse Red 13 methacrylate
Disperse Red 151
Disperse Red 19
Disperse Red 22
Disperse Red 220
Disperse Red 221
Disperse Red 60
Disperse Red 9
Disperse Violet 12
Disperse violet 51
Disperse Violet 9
Disperse violet 98
Disperse Yellow 12
Disperse Yellow 2
Disperse Yellow 218
Disperse Yellow 23
Disperse yellow 3
Disperse Yellow 42
Disperse Yellow 44
Disperse Yellow 56
Disperse Yellow 7
Disperse yellow 7 acrylate
Disperse yellow 7 methacrylate
Disperse Yellow 8
Disperse Yellow 86
Disperse Yellow 87
Disperseblue 19
Dispersionblau 1
Dispersionsblau 3
Dispersionsorange 1
Dispersionsrot 19
Dispersive blue K
Dispersol Fast Yellow T
Disphenol
Dispiro[3H-indole-3,2'-[11,12]-dithiatricyclo[6.2.1.13,6]dodeca-3',5',8',10'-tetraene
Dispiro[5.1.5.1]tetradecane
Dispiro[5.2.5.2]hexadecane-3,12-dione
Dissobutyl
DISSOLVINE PDZ
Distamycin a hydrochloride
distarch glycerol
Distarch phosphate
Distearat des Di-hydroxyethyl-diethylentriaminmonoacetats
Distearic acid, diester with glycerol
Distearin
Distearoyl phosphatidylcholine
Distearoyl phosphatidylcholine
Distearoyl phosphatidylglycerol
Distearoylglycerol
Distearoylphosphatidylethanolamine
Distearoylphosphatidylserine
Distearyl acid phosphate
Distearyl dithiopropionate
Distearyl phosphate
Distearyl sulfide
Distearylamine
Distearylammonium chloride
Distearyldimethylammonium chloride
Distearylpentaerythritol diphosphite
Distearylphosphatidylcholine
Distearylphosphit
Distearyltartrat
Distearylthiodipropionate
Distelöl
Distemonanthus benthamianus
Distickstoffmonoxid
Distickstoffoxid
Distickstoffpentoxid
Distickstofftetrafluorid
Distickstofftetraoxid
Distickstofftetroxid
Distickstofftrioxid
Distigmin
Distigminbromid
distigmine bromide
distillate bases
distillate bases
distillate bases
distillate bases
distillate bases
distillate bases
distillate bases
distillate bases
distillate bases
distillate (petroleum), cracked steam-cracked petroleum distillates
distillate (petroleum), hydrodesulfurized light catalytic cracked
distillate (petroleum), hydrodesulfurized thermal cracked middle
distillate (petroleum), intermediate catalytic cracked
distillate (petroleum), light catalytic cracked
distillate (petroleum), light hydrocracked
distillate (petroleum), light steam-cracked naphtha
distillate (petroleum), light thermal cracked
distillates
distillates (coal), coal tar-residual pyrolysis oils, naphthalene oils
distillates (coal), coke-oven light oil, naphthalene cut
distillates (coal), liq. solvent extn., primary
distillates (coal-petroleum), condensed-ring arom.
distillates (coal), solvent extn., hydrocracked
distillates (coal), solvent extn., hydrocracked hydrogenated middle
distillates (coal), solvent extn., hydrocracked middle
distillates (coal tar)
Distillates (coal tar), benzol fraction
distillates (coal tar), benzol fraction, BTX-rich
distillates (coal tar), benzol fraction, distn. residues
Distillates (coal tar), benzole fraction
distillates (coal tar), heavy oils
distillates (coal tar), heavy oils, pyrene fraction
distillates (coal tar), light oils
distillates (coal tar), light oils, acid exts.
distillates (coal tar), light oils, alk. exts.
distillates (coal tar), light oils, neutral fraction
distillates (coal tar), naphthalene oil crystn. mother liquor
Distillates (coal tar), naphthalene oils
distillates (coal tar), naphthalene oils, acid exts.
distillates (coal tar), naphthalene oils, alk. exts.
distillates (coal tar), naphthalene oils, methylnaphthalene-fraction
distillates (coal tar), naphthalene oils, naphthalene-free, alk. exts.
distillates (coal tar), naphthalene oils, naphthalene-low
distillates (coal tar), pitch
distillates (coal tar), pitch, heavy oils
distillates (coal tar), pitch, pyrene fraction
distillates (coal tar), upper
distillates (coal tar), upper, fluorene-free
distillates (coal tar), upper, fluorene-rich
distillates (petroleum), acid-treated heavy naphthenic
distillates (petroleum), acid-treated heavy paraffinic
distillates (petroleum), acid-treated light
distillates (petroleum), acid-treated light naphthenic
distillates (petroleum), acid-treated light paraffinic
distillates (petroleum), acid-treated middle
Distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, condensed arom. ring-contg.
Distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, heavy fraction
Distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, methylnaphthalene fraction
distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, mixed with high-temp. coal tar, indene fraction
Distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, naphthalene fraction
distillates (petroleum), alkylate
distillates (petroleum), C3-5, 2-methyl-2-butene-rich
distillates (petroleum), C6-rich
distillates (petroleum), C7-9, C8-rich, hydrodesulfurized, dearomatized
Distillates (petroleum), C10-50, used, refined
distillates (petroleum), carbon-treated light paraffinic
distillates (petroleum), catalytic cracked heavy tar light
distillates (petroleum), catalytic reformed depentanizer
distillates (petroleum), catalytic reformed hydrotreated light, C8-12 arom. fraction
distillates (petroleum), catalytic reformed straight-run naphtha overheads
distillates (petroleum), catalytic reformer fractionator residue, high-boiling
distillates (petroleum), catalytic reformer fractionator residue, intermediate-boiling
distillates (petroleum), catalytic reformer fractionator residue, low-boiling
distillates (petroleum), catalytic reformer, heavy arom. conc.
distillates (petroleum), chemically neutralized heavy naphthenic
distillates (petroleum), chemically neutralized heavy paraffinic
distillates (petroleum), chemically neutralized light
distillates (petroleum), chemically neutralized light naphthenic
distillates (petroleum), chemically neutralized light paraffinic
distillates (petroleum), chemically neutralized middle
distillates (petroleum), clay-treated heavy naphthenic
Distillates (petroleum), clay-treated heavy paraffinic
distillates (petroleum), clay-treated light naphthenic
distillates (petroleum), clay-treated light paraffinic
distillates (petroleum), clay-treated middle
distillates (petroleum), clay-treated paraffinic
distillates (petroleum), complex dewaxed heavy paraffinic
distillates (petroleum), complex dewaxed light paraffinic
Distillates (petroleum), cracked, ethylene manuf. by-product, C9-10 fraction
distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C10-12 fraction
distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C8-10 fraction
distillates (petroleum), depentanizer overheads
distillates (petroleum), dewaxed heavy paraffinic, hydrotreated
distillates (petroleum), dewaxed light paraffinic, hydrotreated
Distillates (petroleum), full-range straight-run middle
distillates (petroleum), heat-soaked steam-cracked naphtha, C5-rich
distillates (petroleum), heavy arom.
distillates (petroleum), heavy catalytic cracked
distillates (petroleum), heavy hydrocracked
distillates (petroleum), heavy naphthenic
distillates (petroleum), heavy paraffinic
distillates (petroleum), heavy steam-cracked
Distillates (petroleum), heavy straight-run
distillates (petroleum), heavy thermal cracked
distillates (petroleum), highly refined middle
distillates (petroleum), hydrocracked solvent-refined, dewaxed
distillates (petroleum), hydrocracked solvent-refined light
distillates (petroleum), hydrodesulfurized full-range middle
distillates (petroleum), hydrodesulfurized full-range middle coker
distillates (petroleum), hydrodesulfurized heavy catalytic cracked
distillates (petroleum), hydrodesulfurized intermediate catalytic cracked
Distillates (petroleum), hydrodesulfurized light catalytic cracked
distillates (petroleum), hydrodesulfurized middle
distillates (petroleum), hydrodesulfurized middle coker
Distillates (petroleum), hydrodesulfurized thermal cracked middle
distillates (petroleum), hydrotreated heavy naphtha, deisohexanizer overheads
distillates (petroleum), hydrotreated heavy naphthenic
distillates (petroleum), hydrotreated heavy paraffinic
distillates (petroleum), hydrotreated light
distillates (petroleum), hydrotreated light naphthenic
distillates (petroleum), hydrotreated light paraffinic
distillates (petroleum), hydrotreated middle
distillates (petroleum), hydrotreated middle, intermediate boiling
Distillates (petroleum), intermediate catalytic cracked
distillates (petroleum), intermediate catalytic cracked, thermally degraded
distillates (petroleum), intermediate paraffinic, carbon-treated
distillates (petroleum), intermediate paraffinic, clay-treated
distillates (petroleum), intermediate vacuum
distillates (petroleum), light arom.
Distillates (petroleum), light catalytic cracked
distillates (petroleum), light catalytic cracked, thermally degraded
distillates (petroleum), light distillate hydrotreating process, low-boiling
Distillates (petroleum), light hydrocracked
distillates (petroleum), light naphthenic
distillates (petroleum), light paraffinic
distillates (petroleum), light straight-run gasoline fractionation stabilizer overheads
Distillates (petroleum), light thermal cracked
distillates (petroleum), light thermal cracked, debutanized arom.
distillates (petroleum), light vacuum
distillates (petroleum), naphtha-raffinate pyrolyzate-derived, gasoline-blending
distillates (petroleum), naphtha steam cracking-derived, hydrotreated light arom.
distillates (petroleum), naphtha steam cracking-derived, solvent-refined light hydrotreated
distillates (petroleum), naphtha unifiner stripper
distillates (petroleum), petroleum residues vacuum
distillates (petroleum), polymd. steam-cracked petroleum distillates, C5-12 fraction
Distillates (petroleum), solvent-dewaxed heavy naphthenic
distillates (petroleum), solvent-dewaxed heavy paraffinic
distillates (petroleum), solvent dewaxed heavy paraffinic, clay-treated
distillates (petroleum), solvent-dewaxed light naphthenic
distillates (petroleum), solvent-dewaxed light paraffinic
distillates (petroleum), solvent dewaxed light paraffinic, clay-treated
distillates (petroleum), solvent dewaxed light paraffinic, hydrotreated
Distillates (petroleum), solvent-dewaxed straight-run middle
distillates (petroleum), solvent-dewyxed heavy naphthenic
distillates (petroleum), solvent-refined heavy naphthenic
distillates (petroleum), solvent-refined heavy paraffinic
distillates (petroleum), solvent-refined hydrocracked light
distillates (petroleum), solvent-refined hydrogenated heavy
distillates (petroleum), solvent-refined hydrotreated heavy
distillates (petroleum), solvent-refined light naphthenic
distillates (petroleum), solvent-refined light naphthenic, hydrotreated
distillates (petroleum), solvent-refined light paraffinic
distillates (petroleum), solvent-refined middle
distillates (petroleum), steam-cracked
distillates (petroleum), steam-cracked, C5-10 fraction, mixed with light steam-cracked petroleum naphtha C5 fraction
distillates (petroleum), steam-cracked, C5-12 fraction
distillates (petroleum), steam-cracked, C8-12 fraction
distillates (petroleum), steam-cracked, C8-12 fraction, polymd., distn. lights
distillates (petroleum), steam-cracked heavy tar light
distillates (petroleum), straight-run light
Distillates (petroleum), straight run middle
distillates (petroleum), sweetened middle
distillates (petroleum), thermal-cracked, alkylarom. hydrocarbon-rich
distillates (petroleum), thermal cracked naphtha and gas oil, C5-dimer-contg.
distillates (petroleum), thermal cracked naphtha and gas oil, extractive
distillates (petroleum), thermal cracked naphtha and gasoil
distillates (petroleum), vacuum
Distinct
Distrycillin
Distylin
Distärkephosphat
Disuccinimidyl carbonate
Disuccinoylmonoperoxid
disul
Disul
disul-Na
Disul Natrium-Salz
disul-sodium
Disulergin
disulergine
Disulfamid
disulfamide
disulfane
Disulfid, bis(1-methylethyl)
Disulfide, 1-methylethyl propyl
Disulfide, 2,2-dimethylpropyl methyl
Disulfide, 4-chloro trichloromethyl
Disulfide, bis(1,1-dimethylethyl)
Disulfide, bis(1-methylethyl)
Disulfide, bis(1-methylpropyl)
Disulfide, bis(2,4,5-trichlorophenyl)
Disulfide, bis(2,4-dinitrophenyl)
Disulfide, bis(2-amino-4-sulfamoylphenyl)
Disulfide, bis(2-ethylhexyl)
Disulfide, bis(2-methoxyphenyl)
Disulfide, bis(2-methylphenyl)
Disulfide, bis[2-nitro-4-(trifluoromethyl)phenyl]
Disulfide, bis[2-nitro-α,α,α-trifluoro-p-tolyl]
Disulfide, bis(2-nitrophenyl)
Disulfide, bis(3-methylbutyl)
Disulfide, bis(3-methylphenyl)
Disulfide, bis(3-nitrophenyl)
Disulfide bis[4-(3-chloropropoxy)-1-naphthyl]
Disulfide, bis(4-bromophenyl)
Disulfide, bis(4-chloro-2-nitrophenyl)
Disulfide, bis(4-chlorophenyl)
Disulfide, bis(4-methoxyphenyl)
Disulfide, bis(4-methyl-2-nitrophenyl)
Disulfide, bis(4-methylphenyl)
Disulfide, bis(4-morpholinylthioxomethyl)
Disulfide, bis(4-nitrophenyl)
Disulfide, bis(α,α,α-trifluoro-2-nitro-p-tolyl)
Disulfide, bis(diisopropylthiocarbamoyl)
Disulfide, bis(diphenylmethyl)
Disulfide, bis(methylphenylthiocarbamoyl)
Disulfide, bis(morpholinothiocarbonyl)
Disulfide, bis(p-bromophenyl)
Disulfide, bis(p-methoxyphenyl)
Disulfide, bis(pentafluoroethyl)
Disulfide, bis(phenylmethyl)
Disulfide, bis(phenylsulfonyl)
Disulfide, bis(trifluoromethyl)
Disulfide, butyl ethyl
Disulfide, di-1-naphthalenyl
Disulfide, di-2-naphthalenyl
Disulfide, di-2-propenyl
Disulfide, diacetyl
Disulfide, dibenzoyl
Disulfide, dibutyl
Disulfide, dicyclopentyl
Disulfide, diethoxy
Disulfide, diethyl
Disulfide, diheptyl
Disulfide, dihexadecyl
Disulfide, dimethyl
Disulfide, dipentyl
Disulfide, diphenyl
Disulfide, dipropyl
Disulfide, ethyl 1-methylethyl
Disulfide, ethyl 1-methylpropyl
Disulfide, ethyl 2-methylpropyl
Disulfide, ethyl phenyl
Disulfide, methyl propyl
Disulfide, p-chlorophenyl trichloromethyl
Disulfidpyrithion + Magnesiumsulfat
Disulfidpyrithion + Magnesiumsulfat-Trihydrat
Disulfiram
Disulfiramum
Disulfo Acid E
disulfoglucosamine-6-sulfatase
Disulfone, bis(4-methylphenyl)
Disulfone, di-p-tolyl
Disulfone, diphenyl
disulfoton
disulfoton oxygen analog
Disulfoton sulfone
disulfur bromide
disulfur decafluoride
disulfur dibromide
disulfur dichloride
disulfur difluoride
disulfur difluoride
disulfur diiodide
disulfur oxide
Disulfuryl chloride
Disulphine Blue A
Disulphine Lake Blue A
disulphur bromide
disulphur decafluoride
disulphur dibromide
disulphur dichloride
disulphur difluoride
disulphur difluoride
disulphur diiodide
disulphur oxide
Disuprazol
disuprazole
Disyston
Disyston sulfone
ditalimfos
Ditantalpentaoxid
Ditantalpentoxid
ditantalum decabromide
ditantalum hydride
ditantalum pentoxide
Ditazol
ditazole
ditechnetium heptoxide
Ditekiren
Ditelluride, diephenyl
Ditelluride, diphenyl
ditellurium bromide
ditellurium chloride
ditellurium iodide
diterbium trioxide
diterbium triselenide
diterbium trisulfide
diterbium trisulphide
ditercalinium chloride
Ditercaliniumchlorid
DITERPENE B11 (COLL)
Ditetradecanoylphosphatidylcholine
Ditetradecyl fumarate
Ditetradecyl peroxydicarbonate
Ditetradecylamine
Ditetradecyldimethylammonium bromide
Dithallium carbonate
Dithallium(I)carbonat
dithallium oxide
dithallium selenide
dithallium sulfide
dithallium sulphate
dithallium sulphide
dithallium tetrabromide
dithallium trioxide
Dithalliumsulfat
Dithalliumtetrabromid
Dithalliumtrisulfid
Dithane M-22
Dithane M-45
Dithane R-24
Dithane Z-78
Dithiane
Dithianon
Dithianon (ISO)
Dithianone
dithiazanine iodide
Dithiazaniniodid
Dithieno[2,3-b:3',2'-d]thiophene
Dithio-1,3-dioxan
Dithio-1,4-dioxan
Dithio-6-oxypurine
Dithio-m-hydroxycarbanilic acid S-methyl ester methylcarbamate
Dithioammelide
Dithiobis[thionoformic acid] dibutyl ester
Dithiobiuret
Dithiobrenzkatechin
Dithiocarb
Dithiocarbamic acid
Dithiocarbazic acid compd. with ammonia
Dithiocarbazic acid methyl ester
Dithiocarbonic acid monohydrazide hydrazine salt
Dithiocarbonic acid S-carboxymethyl o-ethyl ester
Dithiocarbonsäure-O-(1-methylethyl)ester Kalium-Salz
Dithiocarbonsäure-O-hexylester Kalium-Salz
Dithiocatechol
Dithiocyanatomethane
dithiodemeton
Dithiodiacetic acid
Dithiodiglycolic acid
Dithioerythritol
Dithioessigsäure-ethylester
Dithioglycolic acid
Dithioglykol
Dithiohydroquinone
Dithiokohlensäure-O-(2-methylpropyl)ester Kalium-Salz
Dithiokohlensäure-O-(2-methylpropyl)ester Natrium-Salz
Dithiokohlensäure-O-ethylester-Kaliumsalz
Dithiokohlensäure-O-ethylester, Natriumsalz
Dithiokohlensäure-O-pentylester Kalium-Salz
Dithiol
Dithioloterephthalic acid
Dithiolterephthalic acid
dithiomidocarbonate
Dithione
Dithionige Säure
Dithionige Säure Diammonium-Salz
Dithionige Säure Dicaesium-Salz
Dithionige Säure Dikalium-Salz
Dithionige Säure Dilithium-Salz
Dithionige Säure Dinatrium-Salz
Dithionige Säure Dirubidium-Salz
Dithionous acid, disodium salt
Dithionsäure
Dithionsäure Diammonium-Salz
Dithionsäure Dicaesium-Salz
Dithionsäure Dikalium-Salz
Dithionsäure Dilithium-Salz
Dithionsäure Dinatrium-Salz
Dithionsäure Dinatrium-Salz Dihydrat
Dithiooxalsäurediamid
Dithiooxamide
Dithiophosphoric acid
Dithiophosphorsäure-O-(2,4-dichlorphenyl)-O-ethyl-S-propylester
Dithiophosphorsäure-O,O-bis(2-methylpropyl)ester Natrium-Salz
Dithiophosphorsäure-O,O-diethyl-S-(2-ethylthio)ethylester
Dithiophosphorsäure-O,O-diethyl-S-(4-chlorphenylthiomethyl)ester
Dithiophosphorsäure-O,O-diethyl-S-ethylthiomethylester
Dithiophosphorsäure-O,O-diethylester Ammoniumsalz
Dithiophosphorsäure-O,O-diisopropyl-S-(2-phenylsulfonylaminoethyl)ester
Dithiophosphorsäure-O,O-dimethyl-S-phthalimidomethylester
Dithiophosphorsäure-S-(2-ethylthioethyl)-O,O-dimethylester
Dithiophosphorsäure-S-(5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl-O,O-dimethylester
Dithiophosphorsäure-S,S'-methylen-O,O,O',O'-tetraethylester
Dithiophosphorsäurediethylester
Dithiopyr
Dithioresorcinol
Dithiosalicylic acid
dithiosystox
Dithioterephthalic acid
Dithiothreitol
Dithiothymine
Dithiouracil
Dithizon
Dithizone
Dithizone silver complex
dithorium trisulfide
dithorium trisulphide
Dithranol
dithulium trioxide
dithulium trisulfide
dithulium trisulphide
Ditiocarb sodium
Ditiocarb sodium
ditiocarb sodium (INN)
Ditiocarbnatrium
Ditiomustin
ditiomustine
dititanium trioxide
Dititantrioxid
Ditolamid
ditolamide
Ditolylether
Ditophal
Ditridecyl sodium sulfosuccinate
ditungsten chloride
ditungsten decachloride
Ditungsten monocarbide
Diugrandine
Diundecyl ketone
Diundecyl phosphate
Diundecyl phthalate
Diundecyl phthalate, branched and linear
Diundecylphthalat
diuranium nonafluoride
diuranium pentoxide
diuranium sulfide
diuranium sulphide
diuranium trinitride
Diurannonafluorid
Diuranpentoxid
Diurea
Diurethane dimethacrylate
Diuretin
Diuron
Diuron (ISO)
Diuvaretin
Divabuterol
Divaleramide
divanadium hydride
divanadium pentaoxide
divanadium pentoxide
Divanadium trioxide
divanadium trisulfide
divanadium trisulphide
Divanadiumpentaoxid
Divanadiumtrioxid
divanadyl pyrophosphate
Divanadylpyrophosphat
Divaplon
Diveratryl ether
Divicin-5-glucosid
Dividend
Divinyl
Divinyl benzene-2-hydroxyethyl methacrylate-methacrylic acid-styrene copolymer
Divinyl benzene-methacrylic acid-styrene copolymer
Divinyl sulfone
Divinyl sulphone
Divinylacetylene
Divinyladipat
Divinylbenzene
Divinylbenzene-1,6-Hexanediol diacrylate copolymer
Divinylbenzene-2-hydroxy-3-(hexadecanoyloxy)propyl methacrylate-styrene copolymer
Divinylbenzene-2-hydroxy-3-phenoxypropyl acrylate-styrene copolymer
Divinylbenzene-2-hydroxyethyl methacrylate-2-isocyanatoethyl methacrylate-methyl methacrylate-octyl methacrylate-vinyl alcohol graft copolymer
Divinylbenzene-2-hydroxyethyl methacrylate-2-isocyanatoethyl methacrylate-stearyl methacrylate graft copolymer
Divinylbenzene-2-hydroxyethyl methacrylate-2-isocyanatoethyl methacrylate-stearyl methacrylate-vinyl alcohol graft copolymer
Divinylbenzene-2-hydroxyethyl methacrylate-glycidyl methacrylate-methacrylic acid-vinyl alcohol graft copolymer
Divinylbenzene-2-hydroxyethyl methacrylate graft copolymer
Divinylbenzene-2-hydroxyethyl methacrylate-hexafluoropropyl methacrylate copolymer
Divinylbenzene-2-hydroxyethyl methacrylate-lauryl acrylate graft copolymer
Divinylbenzene-2-hydroxyethyl methacrylate-methyl methacrylate graft copolymer
Divinylbenzene-2-hydroxyethyl methacrylate-methyl methacrylate-octadecyl methacrylate copolymer
Divinylbenzene-2-hydroxyethyl methacrylate-styrene copolymer
Divinylbenzene-2-hydroxyethyl methacrylate-vinyl alcohol graft copolymer
Divinylbenzene-2-hydroxypropyl methacrylate-styrene copolymer
Divinylbenzene-2-(N-ethylperfluorooctanesulfoamido)ethyl acrylate-Light Acrylate PE-4A copolymer
Divinylbenzene-dipentaerythritol hexaacrylate copolymer
Divinylbenzene-divinylbiphenyl copolymer
Divinylbenzene-Eleminol JS 2 copolymer
Divinylbenzene-ethylene glycol dimethacrylate-2,2,3,3,3-pentafluoropropyl methacrylate-styrene graft copolymer
Divinylbenzene-ethylene glycol dimethacrylate copolymer
Divinylbenzene-ethylene glycol dimethacrylate-styrene-2,2,2-trifluoroethyl methacrylate graft copolymer
Divinylbenzene-ethylene oxide-hydroxyethyl methacrylate-vinyl alcohol graft copolymer methyl ether
Divinylbenzene-ethylene oxide-hydroxyethyl methacrylate-vinyl alcohol graft copolymer methyl ether octylcarbamate
Divinylbenzene-ethylene oxide-hydroxyethyl methacrylate-vinyl alcohol graft copolymer methyl ether stearate
Divinylbenzene-ethylene oxide-hydroxyethyl methacrylate-vinyl alcohol graft copolymer methyl ether stearylcarbamate
Divinylbenzene-ethylene oxide-lauryl methacrylate-vinyl alcohol graft copolymer
Divinylbenzene-ethylene oxide-lauryl methacrylate-vinyl alcohol graft copolymer methyl ether
Divinylbenzene-ethylvinylbenzene copolymer
Divinylbenzene-glycerol triglycidyl ether-glycidyl acrylate-hexafluoroisopropyl methacrylate-2,2,2-trifluoroethyl methacrylate graft copolymer
Divinylbenzene-glycerol triglycidyl ether-glycidyl methacrylate-hexafluoroisopropyl methacrylate graft copolymer
Divinylbenzene-glycidyl allyl ether-2-hydroxyethyl methacrylate-vinyl alcohol graft copolymer
Divinylbenzene-glycidyl allyl ether-polyethylene glycol monomethyl ether monomethacrylate-glycidyl methacrylate copolymer
Divinylbenzene-glycidyl methacrylate-2-hydroxyethyl methacrylate-2-isocyanatoethyl methacrylate graft copolymer
Divinylbenzene-glycidyl methacrylate-2-hydroxyethyl methacrylate-2-isocyanatoethyl methacrylate-methyl methacrylate-vinyl alcohol graft copolymer
Divinylbenzene-glycidyl methacrylate-2-hydroxyethyl methacrylate-2-isocyanatoethyl methacrylate-vinyl alcohol graft copolymer
Divinylbenzene-glycidyl methacrylate-2-hydroxyethyl methacrylate-methoxypolyethylene glycol monomethacrylate graft copolymer
Divinylbenzene-glycidyl methacrylate-2-hydroxyethyl methacrylate-methyl methacrylate graft copolymer
Divinylbenzene-glycidyl methacrylate-2-hydroxyethyl methacrylate-vinyl alcohol graft copolymer
Divinylbenzene-glycidyl methacrylate copolymer
Divinylbenzene-glycidyl methacrylate-methacrylic acid-stearyl methacrylate-vinyl alcohol graft copolymer
Divinylbenzene-glycidyl methacrylate-methyl methacrylate-vinyl alcohol graft copolymer
Divinylbenzene-glycidyl methacrylate-polyethylene glycol monomethyl ether monomethacrylate-copolymer
Divinylbenzene-glycidyl methacrylate-vinyl alcohol graft copolymer
Divinylbenzene-hexafluoroisopropyl methacrylate-2-hydroxyethyl acrylate copolymer
Divinylbenzene-hexafluoroisopropyl methacrylate copolymer
Divinylbenzene-hexafluoroisopropyl methacrylate-methacrylic acid copolymer
Divinylbenzene homopolymer
Divinylbenzene-hydroxyethyl cellulose-methyl methacrylate graft copolymer
Divinylbenzene-hydroxyethyl methacrylate-methoxypolyethylene glycol monomethacrylate-vinyl alcohol graft copolymer
Divinylbenzene-hydroxyethyl methacrylate-methoxypolyethylene glycol monomethacrylate-vinyl alcohol graft copolymer, octylcarbamate
Divinylbenzene-hydroxyethyl methacrylate-methoxypolyethylene glycol monomethacrylate-vinyl alcohol graft copolymer, stearate
Divinylbenzene-hydroxyethyl methacrylate-methoxypolyethylene glycol monomethacrylate-vinyl alcohol graft copolymer, stearylcarbamate
Divinylbenzene-hydroxyethyl methacrylate-polyoxypropylene monoacrylate-vinyl alcohol graft copolymer, stearylcarbamate
Divinylbenzene-hydroxyethyl methacrylate-propylene oxide-vinyl alcohol graft copolymer, stearylcarbamate
Divinylbenzene-hydroxypropyl cellulose graft copolymer
Divinylbenzene-hydroxypropylcellulose;methyl methacrylate graft copolymer
Divinylbenzene-isobornyl methacrylate-isobutyl methacrylate-2-methacryloyloxyethyl isocyanate-stearyl methacrylate-tetramethylolmethane triacrylate copolymer
Divinylbenzene-lauryl acrylate-pentaerythritol tetraacrylate copolymer
Divinylbenzene-lauryl acrylate-vinyl alcohol graft copolymer
Divinylbenzene-lauryl methacrylate-Light Acrylate PE 4A copolymer
Divinylbenzene-lauryl methacrylate-Light Acrylate PE 4A-methyl methacrylate graft copolymer
Divinylbenzene-lauryl methacrylate-methoxypolyethylene glycol monomethacrylate-vinyl alcohol graft copolymer
Divinylbenzene-lauryl methacrylate-styrene copolymer
Divinylbenzene-lauryl methacrylate-styrene-tetramethylolmethane tetraacrylate copolymer
Divinylbenzene-Light Acrylate PE 4A-stearyl methacrylate graft copolymer
Divinylbenzene-manganese(II) 9-p-styryloctadecanoate copolymer
Divinylbenzene-methacrylic acid-vinyl alcohol graft copolymer
Divinylbenzene-methyl methacrylate copolymer
Divinylbenzene-methyl methacrylate graft copolymer
Divinylbenzene-methyl methacrylate-octadecyl methacrylate copolymer
Divinylbenzene-methyl methacrylate-vinyl alcohol graft copolymer
Divinylbenzene-octadecyl fumarate copolymer
Divinylbenzene-octyl methacrylate copolymer
Divinylbenzene-octyl methacrylate-vinyl alcohol graft copolymer
Divinylbenzene-pentaerythritol triacrylate copolymer
Divinylbenzene polymer
Divinylbenzene-potassium 9-p-styryloctadecanoate copolymer
Divinylbenzene-sodium 9-p-styryloctadecanoate copolymer
Divinylbenzene-stearyl acrylate-pentaerythritol tetraacrylate copolymer
Divinylbenzene-stearyl methacrylate copolymer
Divinylbenzene-stearyl methacrylate-vinyl alcohol graft copolymer
Divinylbenzene-styrene copolymer
Divinylbenzene-styrene graft copolymer
Divinylbenzene-TDI-tetramethylolmethane triacrylate copolymer
Divinylbenzene-tetramethylolmethane tetraacrylate copolymer
Divinylbenzene-tetramethylolmethane tetramethacrylate copolymer
Divinylbenzene-tetramethylolmethane tetramethacrylate-styrene copolymer
Divinylbenzene-tetramethylolmethane triacrylate copolymer
Divinylbenzol
Divinylbiphenyl-ethylene glycol dimethacrylate copolymer
Divinylbutyral
Divinyldimethylsilane
Divinylenimin
Divinylether
Divinylethylene
Divinylquecksilber
Divinyltetramethyldisiloxan
Divinyltetramethyldisiloxane
Divinyltetramethyldisiloxane
Divinyltin dichloride
dixanthogen
Dixanthylene
Dixanthylharnstoff
Dixina
Dixylyl sulfone
Dixylyldisulfid
diytterbium trioxide
diytterbium triselenide
diytterbium trisulfide
diytterbium trisulphide
diyttrium trioxide
diyttrium trisulfide
diyttrium trisulphide
Dizatrifon
dizatrifone
dizinc nitride
Dizocilpin
dizocilpine
Dizocilpine maleate
Djenkolic acid
DJM
DKF 901
dl-1,2,3,4-Diepoxybutan
DL-1,2,3,4-Tetrahydroisochinolin-1-carbonsäure Hydrochlorid
DL-1,2,4-triazole-3-alanine
DL-1-(2,5-Diemthoxy-2,5-dihydrofuran-2-yl)-ethanol
DL-1-(2,5-Dimethoxy-2,5-dihydrofuran-2-yl)ethanol
DL-1,2-Dithiolan-3-valeriansäure
DL-1-(2-Furyl)-essigsäureethylester
DL-1-(2-Furyl)-ethanol
DL-1-(2-Furyl)ethyl acetate
DL-1-(2-Furyl)-ethylacetat
DL-1,2-Hexandiol
DL-1,2-Hexanediol
dl-(1,2-Isopropylidene)glycerol tosylate
DL-1-(2-Methoxyphenyl)-ethanol
DL-1-(3,4-Dihydroxyphenyl)-2-isopropylaminoethanol Sulfat Dihydrat
DL-1-(3-Hydroxyphenyl)-2-aminoethanol Hydrochlorid
DL-1,4-Dibrom-2,3-butandiol
DL-1,4-Dibromo-2,3-butanediol
DL-1,4-Dithiothreitol-d10
DL-1-(4-Fluorphenyl)-ethylamin
DL-1-Amino-2-propanol
DL-1-(Aminoethan)-phosphonsäure
DL-1-(Aminoethyl)phosphonic acid
DL-1-Aziridineethanol, α-vinyl-, acetate
DL-1-[Bis-(2-hydroxyethyl)-amino]-2-propanol
DL-1-bromo-2-ethylhexane
DL-1-Bromo-2-methylbutane
DL-(1-Dimethylaminomethyl-1-methyl-propyl)-benzoat
dl-1-(Isopropylamino)-3-(1-naphthyloxy)-2-propanol hydrochlo
DL-1-phenyl-2-aminopropanol-1 HCl
DL-1-Phenylethanol
DL-1-Phenylethylamin
DL-10-Camphorsulfonic acid
DL-10-Camphorsulfonic acid, sodium salt
DL-12-Hydroxyoctadecansäure
DL-12-hydroxystearic acid
DL-12-Hydroxystearinsäure
DL-2-(2-Chlorphenoxy)-propionsäure
DL-2,2'-Diacetoxy-1,1'-binaphthyl
DL-2,3,5,6-Tetrahydro-6-phenylimidazo[2,1-b]thiazole hydroch
DL-2,3-Butanediol, 1,4-bis(dimethylamino)-, dimethanesulfonate, dihydrochloride
DL-2-(3-Chlorophenoxy)propionic acid
DL-2-(3-Chlorphenoxy)-propionsäure
DL-2,3-Diaminopropionic acid monohydrochloride
DL-2,3-Diaminopropionsäure Hydrobromid
DL-2,3-Diaminopropionsäure Hydrochlorid
dl-2,3-Dibromobutane
DL-2,3-Dichlor-2-methylbutan
DL-2,3-Dihydroxypropionaldehyd
DL-2,3-Dimercapto-1-propanesulfonic acid,sodium salt monohydrate
DL-2,3-Dimercaptopropan-1-sulfonsäure Natriumsalz Monohydrat
DL-2-(3-Pyridyl)pyrrolidine
DL-2,4-Diaminobuttersäure Dihydrochlorid
DL-2,4-diaminobutyric acid di HCl
DL-2,4-Diaminobutyric acid dihydrochloride
DL-2,4-Pentandiol
DL-2,4-Pentanediol
DL-2,5,7,8-tetramethyl-2-(4',8',12'-trimethyltridecyl)-6-chromanol
DL-2-Acetamido-3-phenylpropionic acid
DL-2-Acetamido-4-mercaptobuttersäure-γ-thiolacton
DL-2-Acetoxy-2-phenylacetylchlorid
DL-2-Amino-1,2-bis-(p-methoxyphenyl)-äthanol
DL-2-Amino-1-hexanol
DL-2-Amino-1-pentanol
DL-2-Amino-1-propanol
DL-2-Amino-2-hydroxymethyl-3-methylbutyric acid
DL-2-Amino-2-hydroxymethyl-3-phenylpropionic acid
DL-2-Amino-2-hydroxymethyl-4-methylpentanoic acid
DL-2-Amino-3-[3-(5-hydroxyindole)]propionic acid
DL-2-Amino-3,3-dimethylbuttersäure
DL-2-Amino-3-(3-hydroxyphenyl)-propionsäure
DL-2-Amino-3-(4-imidazolyl)propionic acid
DL-2-Amino-3-hydroxy-2-methylpropionic acid
DL-2-Amino-3-hydroxybuttersäure
DL-2-Amino-3-hydroxypropanoic acid 3-phosphate
DL-2-Amino-3-hydroxypropionsäure
DL-2-Amino-3-mercaptopropionic acid
DL-2-Amino-3-mercaptopropionsäure
DL-2-Amino-3-mercaptopropionsäure Hydrochlorid
DL-2-Amino-3-methyl-1-butanol
DL-2-Amino-3-methylbuttersäure
DL-2-Amino-3-methylbutyric acid
(DL)-2-Amino-3-methylpentanoic acid
(DL)-2-Amino-3-methylpentansäure
DL-2-Amino-3-phenylpropionsäure
DL-2-Amino-3-phosphonopropionic acid
DL-2-Amino-3-phosphonopropionsäure
DL-2-Amino-4,4-dichloro-3-butenoic acid
DL-2-Amino-4-(ethylthio)butyric acid
DL-2-Amino-4-hydroxybuttersäure
DL-2-Amino-4-hydroxybutyric acid
DL-2-Amino-4-mercaptobuttersäurelacton Hydrochlorid
DL-2-Amino-4-(methylmercapto)-buttersäure
DL-2-Amino-4-methylpentanoic acid
DL-2-Amino-4-(methylsulfinyl)-buttersäure
DL-2-Amino-4-(methylthio)butyric acid
DL-2-Amino-4-pentenoic acid
DL-2-Amino-4-pentensäure
DL-2-Amino-4-phosphonebuttersäure
DL-2-Amino-4-phosphonobutyric acid
DL-2-Amino-4-sulfobuttersäure
DL-2-Amino-5-guanidinopentanoic acid hydrochloride monohydrate
DL-2-Amino-5-guanidinopentanoic acid monohydrochloride monohydrate
DL-2-Amino-5-phosphonovaleric acid Lithium salt
DL-2-Amino-5-ureidovaleriansäure
DL-2-Amino-5-ureidovaleric acid
DL-2-Amino-7-phosphonoheptanoic acid
DL-2-Aminoadipic acid
DL-2-Aminoadipic acid hydrate
DL-2-Aminoadipinsäure Hydrat
DL-2-Aminobernsteinsäure-4-amid
DL-2-Aminobutanedioic acid
DL-2-Aminobutansäure
DL-2-Aminobuttersäure
DL-2-Aminobutyric acid
DL-2-Aminocapronsäure
DL-2-Aminocaprylsäure
DL-2-Aminoglutaric acid monohydrate
DL-2-Aminoglutarsäure Monohydrat
DL-2-Aminohexanoic acid
DL-2-Aminohexansäure
DL-2-Aminoisobuttersäure
DL-2-Aminoisovaleric acid
DL-2-Aminooctanoic acid
DL-2-Aminooctansäure
DL-2-Aminopropan-1-ol
DL-2-Aminopropanoic acid
DL-2-Aminopropionic acid
DL-2-Aminopropionsäure
DL-2-Aminosuberic acid
DL-2-Aminosuccinamic acid
DL-2-Aminosuccinamic acid monohydrate
DL-2-Aminovaleriansäure
DL-2-Aminovaleric acid
DL-2-Benzoylamino-2-hydroxymethyl-3-methylbutyric acid
DL-2-Benzoylamino-2-hydroxymethyl-3-phenylpropionic acid
DL-2-Benzoylamino-2-hydroxymethyl-4-methylpentanoic acid
DL-2-Benzoylamino-3-hydroxy-2-methylpropionic acid
Dl-2-benzylamino-1-propanol
DL-2-Benzylserin
DL-2-Benzylserine
DL-2-Brombuttersäure
DL-2-Brombuttersäureethylester
DL-2-Brombuttersäuremethylester
DL-2-Bromcapronsäure
DL-2-Bromhexansäure
DL-2-Bromocaproic acid
DL-2-Bromohexanoic acid
DL-2-Bromopropionic acid
DL-2-Brompropionsäure
DL-2-Brompropionsäureethylester
DL-2-Brompropionsäuremethylester
DL-2-Bromvaleriansäureethylester
DL-2-Chloro-2-phenylacetyl chloride
DL-2-Chlorphenylacetylchlorid
DL-2-Cyclopentylglycine
DL-2-Fluorophenylalanine
DL-2-Fluorophenylglycine
DL-2-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)acetic acid
DL-2-Hydroxy-2-phenylessigsäure
DL-2-Hydroxy-3-butenoic acid methyl ester
DL-2-Hydroxy-3-phenylpropionic acid
DL-2-Hydroxy-4-(methylthio)buttersäure
DL-2-Hydroxy-4-methylvaleriansäure
DL-2-Hydroxy-4-methylvaleric acid
DL-2-Hydroxycapronsäure
DL-2-Hydroxycapronsäureethylester
DL-2-Hydroxydecanoic acid methyl ester
DL-2-Hydroxyhexansäure
DL-2-Hydroxyhexansäureethylester
DL-2-(Hydroxymethyl)-6-methoxy-α-methyl-2-naphtahalin
DL-2-Hydroxypropanoic acid
DL-2-Hydroxypropansäure
DL-2-hydroxystearic acid methyl ester
DL-2-Hydroxyvaleriansäure NatriumsalzHydrat
DL-2-Hydroxyvaleriansäure NatriumsalzHydrat
DL-2-Hydroxyvaleric acid, sodium salt,hydrate
DL-2-Isobutylserin
DL-2-Isobutylserine
DL-2-Isopropylserine
DL-2-Methoxy-α-methylbenzyl alcohol
DL-2-Methyl-1-butanol
DL-2-Methyl-2-hepten-6-ol
DL-2-Methyl-2-hepten-6-ol (6-5-2)
DL-2-Methylbuttersäure
DL-2-Methylbuttersäurechlorid
DL-2-Methylbutyric acid
DL-2-Methylbutyryl chloride
DL-2-Methylbutyrylchlorid
DL-2-Methylglutamic acid
DL-2-Methylglutamic acid hemihydrate
DL-2-Methylglutaminsäure Hemihydrat
DL-2-Methylleucine
DL-2-Methylserin Hydrat
DL-2-Methylserine hydrate
DL-2-Octanol
DL-2-Oxotetrahydrofuran-4,5-dicarbonsäure
DL-2-Oxotetrahydrofuran-4,5-dicarboxylic acid
DL-2-Pentanol
DL-2-Phenoxypropionic acid
DL-2-Phenyl-1-butanol
DL-2-Phenyl-3-butyn-2-ol
DL-2-Phenylglycin
DL-2-Phenylpropionaldehyd
DL-2-Phenylpropionaldehyde
DL-2-Phenylpropionic acid
DL-2-Phenylpropionsäure
dl-2-Phthalimidoglutaramic acid
DL-2-Pinen
DL-2-Piperidinecarboxylic acid
DL-2-Pyrrolidon-5-carbonsäure
DL-2-Pyrrolidone-5-carboxylic acid
DL-2-(tert-Butyl)glycine
DL-2-Undecanol
DL-2'-Methylphenylalanin hydrochlorid
DL-2'-Methylphenylalanine hydrochloride
DL-3-(1-Acetoxy-1-methylethyl)-6-oxoheptanenitrile
DL-3-(1-Acetoxy-1-methylethyl)-6-oxoheptannitril
DL-3-(1-Methyl-1-ethenyl)-6-oxoheptanenitrile
DL-3-(1-Methyl-1-ethenyl)-6-oxoheptannitril
DL-3-(1-naphthyl)alanine
DL-3-(2-naphthyl)alanine
DL-3-(3,4-Dihydroxyphenyl)alanine
DL-3,4-Dihydroxymandelic acid
DL-3,4-Dihydroxymandelsäure
DL-3,4-dihydroxyphenyl glycol
DL-3,5-Difluorophenylalanine
dl-3,8-Diaza-5,6-dihydroxy-decanedithiol-1,10-dihydrochloride
dl-3,8-Diaza-5,6-dihydroxydecane-1,10-dithiol dihydrochloride
DL-3-(α-Acetonyl-4'-chlorobenzyl)-4-hydroxycoumarin
DL-3-Acetoxybutyric acid ethyl ester
DL-(3-amino-3-carboxypropyl)dimethylsulfonium chloride
DL-3-Amino-3-phenylpropionic acid
DL-3-Amino-3-phenylpropionsäure
DL-3-Amino-n-butyric acid
DL-3-Aminobuttersäure
DL-3-Aminoisobuttersäure Monohydrat
DL-3-Aminoisobutyric acid
DL-3-Fluorophenylalanine
DL-3-Fluorotyrosine
DL-3-Hydroxy-2-phenylpropionic acid
DL-3-Hydroxy-2-phenylpropionsäure
(DL-3-Hydroxy-3-methylglutaryl)-coenzyme A disodium salt trihydrate
DL-3-Hydroxy-4-methoxymandelic acid
DL-3-Hydroxy-4-methoxymandelsäure
DL-3-Hydroxybuttersäure Natriumsalz
DL-3-Hydroxybutyric acid-4-13C sodium salt
DL-3-Hydroxybutyric acid, sodium salt
DL-3-hydroxymandelic acid
DL-3-Hydroxynorvaline
DL-3-methoxymandelic acid
DL-3-Methyl-2-butanol
DL-3-Methyl-2-oxopentanoic acid, sodiumsalt
DL-3-Methylcyclopentanon
DL-3-Methylcyclopentanone
DL-3-Methylenecyclopropane-trans-1,2-dicarboxylic acid
DL-3(Methylmercapto)-2-butanon
DL-3-(Methylthio)-2-butanone
DL-3-Methylvaleriansäure
DL-3-Methylvaleric acid
DL-3-Octanol
DL-3-Phenyl-1-butin-3-ol
DL-3-Phenyl-1-butin-3-ol (2-3-2)
DL-3-Phenyllactic acid
DL-3-Pyrrolidinol
DL-4-Amino-3-hydroxybuttersäure
DL-4-Amino-3-hydroxybutyric acid
DL-4-Amino-N10-methylpteroylglutamic acid
DL-4-Amino-N10-methylpteroylglutaminsäure
DL-4-Aminobenzylsuccinic acid
DL-4-Chlor-phenylalanin
DL-4-Chloro-2-(α-methylbenzyl)phenol
DL-4-Chloro-α-cyclopropyl-α-methylbenzyl alcohol
DL-4-Chlorophenylalanine
DL-4-Chlorophenylalanine ethyl ester hydrochloride
DL-4-Chlorophenylalanine methyl ester hydrochloride
DL-4-Chlorophenylalaninol
DL-4-Dimethylamino-1,2-diphenyl-3-methyl-2-butanol HCl
DL-4-Dimethylamino-1,2-diphenyl-3-methyl-2-butanol hydrochloride
DL-4-Fluoro-α-methylbenzylamine
DL-4-Fluorophenylalanine
DL-4-hydroxy-3-methoxy-mandelic acid
DL-4-Hydroxy-3-methoxymandelsäure
DL-4-Hydroxy-3-methoxyphenylglycol, piperazine salt
DL-4-Hydroxy-3-methoxyphenylglykol Hemipiperazinsalz
DL-4-Hydroxymandelic acid
DL-4-Hydroxymandelic acid monohydrate
DL-4-Hydroxymandelonitrile
DL-4-Hydroxymandelsäure
DL-4-Hydroxymandelsäure Monohydrat
DL-4-(Trifluormethyl)-mandelsäure
DL-5-(1,2-Dithiolan-3-yl)valeramid
dl-5,6-Dihydroxy-1,10-dimercapto-3,8-diazadecane dihydrochloride
DL-5,7,8-Trimethyltocol
1 2 3 4 5 6 7 8 9 A  B C D E F G H I J K L M N O  P Q R S T U V W X Y Z 

<< < 1... 21... 41... 61... 81... 101... 121... 131 132 133 134 135 136 137 138 139 140 141 ...161 ...181 ...201 ...221 ...241 > >>


Seiteninfo: Impressum | Letzte Aktualisierung am 29. Dezember 2007 durch Ron Zenczykowski

Blättern: Seitenanfang